Chemical Report for: 16-hydroxypalmitateGeneral Type | | Natural, Fatty acid, Hexadecanoate, Palmitate | Chemical_Nomenclature | | 16-hydroxyhexadecanoic acid | Canonical SMILES | | C(CCCCCCCC(=O)O)CCCCCCCO | InChI | | InChI=1S/C16H32O3/c17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16(18)19/h17H,1-15H2,(H,18,19) | InChIKey | | UGAGPNKCDRTDHP-UHFFFAOYSA-N
| Other name(s) | | 16-hydroxypalmitic acide ; 16-hydroxyhexadecanoic acide ; Juniperic acid ; Hexadecanoic acid, 16-hydroxy- ; Palmitic acid, 16-hydroxy- |
________________________________________________________________________________________________ |
Target Families | | | 16-hydroxypalmitate ligand of proteins in family: Lipase_3 | Stucture | | | 1 structure: 4GI1: Structure of the complex of three phase partition treated lipase from Thermomyces lanuginosa with 16-hydroxypalmitic acid at 2.4 A resolution | Protein | | | humla-1lipa |
|
|