Substrate Report for: Retinol-acetateRetinyl Acetate is a naturally-occurring fatty acid ester form of retinol (vitamin A) with potential antineoplastic and chemopreventive activities. Retinyl acetate binds to and activates retinoid receptors, inducing cell differentiation and decreasing cell proliferation
General Type | | Retinol ester, Natural, Acetate | Chemical_Nomenclature | | [(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenyl] acetate | Canonical SMILES | | CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CCOC(=O)C)C)Ce | InChI | | InChI=1S/C22H32O2/c1-17(9-7-10-18(2)14-16-24-20(4)23)12-13-21-19(3)11-8-15-22(21,5)6/h7,9-10,12-14H,8,11,15-16H2,1-6H3/b10-7+,13-12+,17-9+,18-14+ | InChIKey | | QGNJRVVDBSJHIZ-QHLGVNSISA-N
| Other name(s) | | LMPR01090012 ; Retinol Acetate ; All-trans-retinyl Acetate ; Retinyl acetate ; Vitamin A acetate ; Retinol, acetate |
________________________________________________________________________________________________ |
|