Inhibitor Report for: 1-methylindol-3-oneProduct of hydrolysis of N-Methylindoxyl-acetate General | Type | | Indole | | Chemical_Nomenclature | | 1-methyl-2H-indol-3-one | | Canonical SMILES | | CN1CC(=O)C2=CC=CC=C21 | | InChI | | InChI=1S/C9H9NO/c1-10-6-9(11)7-4-2-3-5-8(7)10/h2-5H,6H2,1H3 | | InChIKey | | DYPFVQQCYZKNMK-UHFFFAOYSA-N
| | Other name(s) | | 3H-Indol-3-one, 1,2-dihydro-1-methyl- ; SCHEMBL6366299 ; 1-Methyl-1,2-Dihydro-3h-Indol-3-One |
________________________________________________________________________________________________ |
Target | Families | | | 1-methylindol-3-one ligand of proteins in family: ACHE | | Stucture | | | 1 structure: 5IH7: Acetylcholinesterase of Torpedo californica in complex with the N-methyl-indoxylacetate hydrolysis products | | Protein | | | torca-ACHE |
|
