Inhibitor Report for: CyC-7beta-openGeneral | Type | | Organophosphate, Cyclic OP open, Lipase inhibitor | | Chemical_Nomenclature | | methoxy-[(~{E},3~{R})-3-[(2~{R})-1-methoxy-1,3-bis(oxidanylidene)butan-2-yl]tridec-11-enyl]phosphinic acid | | Canonical SMILES | | C/C=C/CCCCCCC[C@H](CCP(=O)(O)OC)[C@H](C(=O)C)C(=O)OC | | InChI | | InChI=1S/C19H35O6P/c1-5-6-7-8-9-10-11-12-13-17(14-15-26(22,23)25-4)18(16(2)20)19(21)24-3/h5-6,17-18H,7-15H2,1-4H3,(H,22,23)/b6-5+/t17-,18+/m1/s1 | | InChIKey | | KFPPYXMTKZSOKI-VGRIIWOTSA-N
| | Other name(s) | | CyC7b ; CyC-7b ; IY8 |
________________________________________________________________________________________________ |
Target | Families | | | CyC-7beta-open ligand of proteins in family: A85-Mycolyl-transferase | | Stucture | | | 1 structure: 7ZM1: Crystal structure of HsaD from Mycobacterium tuberculosis in complex with Cyclophostin-like inhibitor CyC7b | | Protein | | | myctu-a85c |
|
