Inhibitor Report for: SBP-7957General | Type | | Morpholine, Thiazolidine, Sulfur compound, Sulfonamide | | Chemical_Nomenclature | | 4-[4-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]phenyl]sulfonylmorpholine | | Canonical SMILES | | C1COCCN1S(=O)(=O)C2=CC=C(C=C2)C3=CSC(=N3)C4=CC=C(C=C4)F | | InChI | | InChI=1S/C19H17FN2O3S2/c20-16-5-1-15(2-6-16)19-21-18(13-26-19)14-3-7-17(8-4-14)27(23,24)22-9-11-25-12-10-22/h1-8,13H,9-12H2 | | InChIKey | | JYTYZKKXJTUPJO-UHFFFAOYSA-N
| | Other name(s) | | ZEG ; SCHEMBL17073130 ; ZINC8225552 ; AKOS000988682 ; MCULE-8947216331 ; NCGC00304034-01 |
________________________________________________________________________________________________ |
Target | Families | | | SBP-7957 ligand of proteins in family: Thioesterase | | Stucture | | | 1 structure: 7MHE: Thioesterase Domain of Human Fatty Acid Synthase (FASN-TE) binding a competitive inhibitor SBP-7957 | | Protein | | | human-FASN |
References: Search PubMed for references concerning: SBP-7957No Reference |
