Substrate Report for: L-homoserineGeneral | Type | | Peptide, Homoserine | | Chemical_Nomenclature | | (2S)-2-amino-4-hydroxybutanoic acid | | Canonical SMILES | | C(CO)C(C(=O)O)N | | InChI | | InChI=1S/C4H9NO3/c5-3(1-2-6)4(7)8/h3,6H,1-2,5H2,(H,7,8)/t3-/m0/s1 | | InChIKey | | UKAUYVFTDYCKQA-VKHMYHEASA-N
| | Other name(s) | | (s)-2-amino-4-hydroxybutanoic acid ; (s)-homoserine ; (S)-2-Amino-4-hydroxybutyric acid ; (2S)-2-amino-4-hydroxybutanoic acid |
________________________________________________________________________________________________ |
Target | Families | | | L-homoserine ligand of proteins in family: Homoserine_transacetylase | | Stucture | | | 1 structure: 6IOH: Crystal structure of Homoserine O-acetyltransferase in complex with Homoserine from Mycobacterium smegmatis ATCC 19420 | | Protein | | | bacce-BC4730 |
References:
Title: Crystal structure of homoserine O-succinyltransferase from Bacillus cereus at 2.4 A resolution
Zubieta C, Krishna SS, McMullan D, Miller MD, Abdubek P, Agarwalla S, Ambing E, Astakhova T, Axelrod HL and Wilson IA <33 more author(s)>
Zubieta C, Krishna SS, McMullan D, Miller MD, Abdubek P, Agarwalla S, Ambing E, Astakhova T, Axelrod HL, Carlton D, Chiu HJ, Clayton T, Deller M, DiDonato M, Duan L, Elsliger MA, Grzechnik SK, Hale J, Hampton E, Han GW, Haugen J, Jaroszewski L, Jin KK, Klock HE, Knuth MW, Koesema E, Kumar A, Marciano D, Morse AT, Nigoghossian E, Oommachen S, Reyes R, Rife CL, van den Bedem H, Weekes D, White A, Xu Q, Hodgson KO, Wooley J, Deacon AM, Godzik A, Lesley SA, Wilson IA (- 33)
Ref: Proteins, 68:999, 2007 : PubMed
|
