Inhibitor Report for: 17-desoxypancuronium
17-desoxypancuronium | Type | Nicotinic antagonist |
| | Neuromuscular Nondepolarizing Agents |
| | Not A/B H target |
| | Acetate |
| Other_Name (8) |
| Chemical_Nomenclature | [(2S,3S,5S,8R,9S,10S,13S,14S,16S,17R)-17-hydroxy-10,13-dimethyl-2,16-bis(1-methylpiperidin-1-ium-1-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| Formula | C33H58N2O3+2 |
| CAS_number | 43021-45-0 |
| MW | 530.82 |
|  |
| Kinetic_parameter | 17-desoxypancuronium_WT_human-BCHE |
| | 17-desoxypancuronium_D70G_human-BCHE |
| Paper | Kalow_1958_Biochem.Pharmacol_1_183 |
| | Whittaker_1981_Hum.Hered_31_242 |
| | Lockridge_1990_Pharmacol.Ther_47_35 |
| Comment | Dacuronium, 17-desoxy analog of pancuronium |
| | 17-desoxy analog of pancuronium |
| Kin_Inhibitor | 17-desoxypancuronium |
| CID (5) |
| Family | BCHE |
| InChIKey (5) |
| CanonicalSMILES | CC(=O)OC1CC2CCC3C(C2(CC1[N+]4(CCCCC4)C)C)CCC5(C3CC(C5O)[N+]6(CCCCC6)C)C |
| InChI | InChI=1S/C33H58N2O3/c1-23(36)38-30-20-24-12-13-25-26(33(24,3)22-29(30)35(5)18-10-7-11-19-35)14-15-32(2)27(25)21-28(31(32)37)34(4)16-8-6-9-17-34/h24-31,37H,6-22H2,1-5H3/q+2/t24-,25+,26-,27-,28-,29-,30-,31-,32-,33-/m0/s1 |
|
|