Inhibitor Report for: 2-Chloroprocaine
2-Chloroprocaine | Type | Local anesthetic |
| | Not A/B H target |
| Other_Name (10) |
| Chemical_Nomenclature | 4-amino-2-chlorobenzoic acid 2-diethylaminoethyl ester hydrochlorid |
| Formula | C13H19ClN2O2 |
| CAS_number | 3858-89-7 |
| MW | 270.755 |
| |
| Paper | Henderson_1993_J.Clin.Anesth_5_129 |
| | Maes_2016_Acta.Anaesthesiologica.Scandinavica_60_642 |
| | Lockridge_1990_Pharmacol.Ther_47_35 |
| Comment | Local anesthetic, the hydrochloride is Nesacaine |
| | Chloroprocaine Hydrochloride is a synthetic, aminoester, local, anesthetic agent. Chloroprocaine hydrochloride acts by inhibiting sodium influx through binding to specific membrane sodium ion channels in the neuronal cell membranes, restricting sodium permeability, and blocking nerve impulse conduction. This leads to a loss of sensation. Chloroprocaine hydrochloride is short-acting due to rapid hydrolysis by pseudocholinesterase into para-aminobenzoic acid in plasma. Chloroprocaine has a significantly shorter duration of action than lidocaine and is significantly less toxic. |
| Gene_locus | human-BCHE |
| CID | 8612 |
| | 441348 |
| | 19727 |
| Family | BCHE |
| InChIKey | VDANGULDQQJODZ-UHFFFAOYSA-N |
| | SZKQYDBPUCZLRX-UHFFFAOYSA-N |
| CanonicalSMILES | CCN(CC)CCOC(=O)C1=C(C=C(C=C1)N)Cl |
| | CC[NH+](CC)CCOC(=O)C1=C(C=C(C=C1)N)Cl.[Cl-] |
| | CCN(CC)CCOC(=O)C1=C(C=C(C=C1)N)Cl.Cl |
| InChI | InChI=1S/C13H19ClN2O2/c1-3-16(4-2)7-8-18-13(17)11-6-5-10(15)9-12(11)14/h5-6,9H,3-4,7-8,15H2,1-2H3 |
| | InChI=1S/C13H19ClN2O2.ClH/c1-3-16(4-2)7-8-18-13(17)11-6-5-10(15)9-12(11)14;/h5-6,9H,3-4,7-8,15H2,1-2H3;1H |
| IupharLig | 7145 |
| Wikipedia | Chloroprocaine |
|
|