Inhibitor Report for: Alogliptin
| Alogliptin | Type (5) |
|---|
| Other_Name (6) |
| Chemical_Nomenclature | 2-[[6-[(3R)-3-aminopiperidin-1-yl]-3-methyl-2,4-dioxopyrimidin-1-yl]methyl]benzonitrile |
| Formula | C18H21N5O2 |
| CAS_number | 850649-61-5 |
| MW | 339.39 |
|  |
| Paper | Xie_2012_Eur.J.Med.Chem_52_205 |
| | Feng_2007_J.Med.Chem_50_2297 |
| | Zhang_2011_J.Med.Chem_54_510 |
| Structure | 3G0B |
| | 2ONC |
| Comment | Alogliptin is a selective, orally bioavailable, pyrimidinedione-based inhibitor of dipeptidyl peptidase 4 (DPP-4), with hypoglycemic activity. Almost identical to Trelagliptin which is a fluride derivative (Alogliptin cation CID 26322458 in structure 3G0B) |
| Gene_locus | human-DPP4 |
| CID | 11450633 |
| Family | DPP4N_Peptidase_S9 |
| InChIKey | ZSBOMTDTBDDKMP-OAHLLOKOSA-N |
| CanonicalSMILES | CN1C(=O)C=C(N(C1=O)CC2=CC=CC=C2C#N)N3CCCC(C3)N |
| InChI | InChI=1S/C18H21N5O2/c1-21-17(24)9-16(22-8-4-7-15(20)12-22)23(18(21)25)11-14-6-3-2-5-13(14)10-19/h2-3,5-6,9,15H,4,7-8,11-12,20H2,1H3/t15-/m1/s1 |
| IupharLig | 6319 |
| Wikipedia | Alogliptin |
|
|
|
