Substrate Report for: Ampicillin
Ampicillin | Type | Antibiotic |
| | Azabicyclo |
| Other_Name | Aminobenzylpenicillin |
| | Ampicillin acid |
| | Amcill |
| | Ampicilline |
| | Polycillin |
| Chemical_Nomenclature | (2S,5R,6R)-6-[[(2R)-2-amino-2-phenylacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| Formula | C16H19N3O4S |
| MW | 349.40 |
| |
| Paper | Blum_2010_J.Mol.Catal.B.Enzym_67_21 |
| | Barends_2006_J.Biol.Chem_281_5804 |
| | Zhou_2019_Sci.Rep_9_15564 |
| | Barends_2003_Acta.Crystallogr.D.Biol.Crystallogr_59_2237 |
| Structure | 1NX9 |
| Comment | Ampicillin is a broad-spectrum, beta-lactam penicillin antibiotic. Ampicillin binds to and inactivates penicillin-binding proteins (PBP) located on the inner membrane of the bacterial cell wall. This interrupts bacterial cell wall synthesis. |
| Gene_locus | xanax-GAA |
| | acepa-AEHA |
| | pig-EST1 |
| | pig-a0a1s6l967 |
| CID | 6249 |
| Family | Cocaine_esterase |
| | Peptidase_S15 |
| | Carb_B_Chordata |
| InChIKey | AVKUERGKIZMTKX-NJBDSQKTSA-N |
| CanonicalSMILES | CC1(C(N2C(S1)C(C2=O)NC(=O)C(C3=CC=CC=C3)N)C(=O)O)C |
| InChI | InChI=1S/C16H19N3O4S/c1-16(2)11(15(22)23)19-13(21)10(14(19)24-16)18-12(20)9(17)8-6-4-3-5-7-8/h3-7,9-11,14H,17H2,1-2H3,(H,18,20)(H,22,23)/t9-,10-,11+,14-/m1/s1 |
| Wikipedia | Ampicillin |
|
|