Inhibitor Report for: Carbachol
Carbachol | Type (5) |
| Other_Name | Carbamylcholine |
| | Carbamoylcholine |
| | Carbastat |
| | Carbacholin |
| | Carbacholine |
| | Carbacolina |
| | Carbamiotin |
| | Carbocholin |
| | Carbocholine |
| | Carbochol |
| | Carcholin |
| | Miostat |
| | Carbacholinum |
| | Karbachol |
| | 2-[(Aminocarbonyl)oxy]-N,N,N-trimethylethanaminium chloride |
| | (2-hydroxyethyl)trimethylammonium chloride carbamate |
| | 2-carbamoyloxyethyl-trimethyl-ammonium |
| Chemical_Nomenclature | 2-carbamoyloxyethyl(trimethyl)azanium;chloride |
| Formula | C6H15N2O2 |
| CAS_number | 51-83-2 |
| MW | 147.196 |
|  |
| Paper | Auletta_2010_Chem.Biol.Interact_187_135 |
| | Rosenberry_2008_Biochemistry_47_13056 |
| | Rosenberry_2008_Chem.Biol.Interact_175_235 |
| Comment | Carbachol is a synthetic choline ester and a positively charged quaternary ammonium compound. Carbachol is a parasympathomimetic that mimics the effect of acetylcholine on both the muscarinic and nicotinic receptors. This drug is administered ocularly to induce miosis to reduce intraocular pressure in the treatment of glaucoma. Carbachol is also used to stimulate micturition by contraction of detrusor muscle. This drug may cause hypotension, bradycardia, nausea, vomiting, bronchospasm, and abdominal cramps. As a carbamate it is a slowly hydrolyzed substrate of acetylcholinesterase |
| CID | 5831 |
| | 2551 |
| Family | ACHE |
| | BCHE |
| InChIKey | AIXAANGOTKPUOY-UHFFFAOYSA-N |
| CanonicalSMILES | C[N+](C)(C)CCOC(=O)N.[Cl-] |
| InChI | InChI=1S/C6H14N2O2.ClH/c1-8(2,3)4-5-10-6(7)9;/h4-5H2,1-3H3,(H-,7,9);1H |
| Wikipedia | Carbachol |
|
|