Substrate Report for: Carbachol
Carbachol | Type (6) |
| Other_Name (13) |
| Chemical_Nomenclature | 2-[(Aminocarbonyl)oxy]-N,N,N-trimethylethanaminium chloride; (2-hydroxyethyl)trimethylammonium chloride carbamate ; 2-carbamoyloxyethyl-trimethyl-ammonium |
| Formula | C6H15N2O2 |
| CAS_number | 51-83-2 |
| MW | 147.196 |
| |
| Paper | Auletta_2010_Chem.Biol.Interact_187_135 |
| | Rosenberry_2008_Biochemistry_47_13056 |
| | Rosenberry_2008_Chem.Biol.Interact_175_235 |
| Comment | Parasympathomimetic, Cholinergic receptor agonist, as a carbamate it is a slowly hydrolyzed substrate of acetylcholinesterase. This drug is administered ocularly to induce miosis to reduce intraocular pressure in the treatment of glaucoma. Carbachol is also used to stimulate micturition by contraction of detrusor muscle. This drug may cause hypotension, bradycardia, nausea, vomiting, bronchospasm, and abdominal cramps. |
| CID | 5831 |
| Family | ACHE |
| InChIKey | AIXAANGOTKPUOY-UHFFFAOYSA-N |
| CanonicalSMILES | C[N+](C)(C)CCOC(=O)N.[Cl-] |
| InChI | InChI=1S/C6H14N2O2.ClH/c1-8(2,3)4-5-10-6(7)9;/h4-5H2,1-3H3,(H-,7,9);1H |
| IupharLig | 298 |
| Wikipedia | Carbachol |
|
|