Inhibitor Report for: Coelenteramide
Coelenteramide | Type | Natural |
| | Luciferin |
| Other_Name (5) |
| Chemical_Nomenclature | N-[3-benzyl-5-(4-hydroxyphenyl)pyrazin-2-yl]-2-(4-hydroxyphenyl)acetamide |
| Formula | C25H21N3O3 |
| CAS_number | 50611-86-4 |
| MW | 411.5 |
| |
| Paper | Schenkmayerova_2023_Nat.Catal_6_23 |
| | Schenkmayerova_2020_ChemRxiv__ |
| | Loening_2007_J.Mol.Biol_374_1017 |
| | Gao_2023_ChemCatChem_15_e202300745 |
| Structure | 6YN2 |
| | 7QXQ |
| | 7OMR |
| | 2PSJ |
| Comment | Derives from an Oplophorus luciferin. The postcatalytic enzyme-product. |
| | The most common marine luciferin. Luciferase from Renilla reniformis (RLuc) catalyzes the degradation of coelenterazine in the presence of molecular oxygen, resulting in the product coelenteramide, carbon dioxide, and the desired photon of light (EC 1.13.12.5). This enzyme belongs to the Haloalkane dehalogenase family II with a different catalytic function (EC 3.8.1.5) Reconstruction of an ancestral enzyme shows it has both hydrolase and monooxygenase activities ( Chaloupkova et al.) |
| Gene_locus | renre-luc |
| CID | 5326781 |
| | 448487 |
| Family | Haloalkane_dehalogenase-HLD2 |
| InChIKey | CJIIERPDFZUYPI-UHFFFAOYSA-N |
| CanonicalSMILES | C1=CC=C(C=C1)CC2=NC(=CN=C2NC(=O)CC3=CC=C(C=C3)O)C4=CC=C(C=C4)O |
| InChI | InChI=1S/C25H21N3O3/c29-20-10-6-18(7-11-20)15-24(31)28-25-22(14-17-4-2-1-3-5-17)27-23(16-26-25)19-8-12-21(30)13-9-19/h1-13,16,29-30H,14-15H2,(H,26,28,31) |
|
|