Inhibitor Report for: FP-Desthiobiotin
FP-Desthiobiotin | Type | Organophosphate |
| | ABPP-Probe |
| | Biotin derivative |
| Other_Name | ActivX Desthiobiotin-FP |
| | ActivX DTB-FP |
| | DTB-FP |
| Chemical_Nomenclature | Ethyl (10-(6-((4R,5S)-5-methyl-2-oxoimidazolidin-4-yl)hexanamido)decyl)phosphonofluoridate |
| Formula | C22H43FN3O4P |
| CAS_number | 1811556-65-6 |
| MW | 463.57 |
|  |
| Paper | Goo_2014_Arterioscler.Thromb.Vasc.Biol_34_386 |
| | Dehghani_2023_J.Pharm.Sci__ |
| | Liu_2022_Anal.Chem_94_8625 |
| Comment | Serine Hydrolase probe consisting of a tag linked to a fluorophosphonate (FP) group, which specifically and covalently labels serines of enzymatically active serine hydrolases. ABPP-Probe (activity based protein profiling probe) |
| CID | 145710413 |
| Family | LIDHydrolase |
| InChIKey | AKIGUFDWVLQSPA-LVQXAQMUSA-N |
| CanonicalSMILES | CCO[P](=O)(CCCCCCCCCCN(C(=O)CCCCC[C@@H]1[C@@H](N(C(=O)N1[H])[H])C)[H])F |
| InChI | InChI=1S/C22H43FN3O4P/c1-3-30-31(23,29)18-14-9-7-5-4-6-8-13-17-24-21(27)16-12-10-11-15-20-19(2)25-22(28)26-20/h19-20H,3-18H2,1-2H3,(H,24,27)(H2,25,26,28)/t19-,20+,31?/m0/s1 |
|
|