Inhibitor Report for: Fluoropezil
Fluoropezil | Type | Multitarget |
| | Derivative of Donepezil |
| | Sulfur Compound |
| | Antioxidant |
| Other_Name (8) |
| Chemical_Nomenclature | 2-Fluoro-2-((1-(3-fluorobenzyl)piperidin-4-yl)methyl)-5,6-dimethoxy-2,3-dihydrobenzo[b]thiophene 1,1-dioxide |
| | 2-fluoro-2-[[1-[(3-fluorophenyl)methyl]piperidin-4-yl]methyl]-5,6-dimethoxy-3H-1-benzothiophene 1,1-dioxide |
| Formula | C23H27F2NO4S |
| MW | 451.52 |
| |
| Paper | Liu_2022_Eur.J.Med.Chem_235_114305 |
| | Guo_2022_Bioanalysis_14_817 |
| | Guo_2021_Anal.Bioanal.Chem_413_5835 |
| | Qian_2022_ResearchSquare__ |
| Comment | AChe IC50 = 2.4 nM. 24r is a mixed-type inhibitor against AChE Ki value equal to 0.4 nM. 24r reduced tau phosphorylation at S396 and Abeta aggregation in the presence of AChE |
| Gene_locus | human-ACHE |
| CID | 163409065 |
| Family | ACHE |
| InChIKey | IVJYMZOWJKEUNR-UHFFFAOYSA-N |
| CanonicalSMILES | C1=CC(=CC(=C1)CN2CCC(CC2)CC4(CC3=CC(=C(C=C3[S]4(=O)=O)OC)OC)F)F |
| | COC1=C(C=C2C(=C1)CC(S2(=O)=O)(CC3CCN(CC3)CC4=CC(=CC=C4)F)F)OC |
| InChI | InChI=1S/C23H27F2NO4S/c1-29-20-11-18-14-23(25,31(27,28)22(18)12-21(20)30-2)13-16-6-8-26(9-7-16)15-17-4-3-5-19(24)10-17/h3-5,10-12,16H,6-9,13-15H2,1-2H3 |
|
|