Inhibitor Report for: Hypaphorine
| Hypaphorine | Type (5) |
|---|
| Other_Name (17) |
| Chemical_Nomenclature | (2S)-3-(1H-indol-3-yl)-2-(trimethylazaniumyl)propanoate |
| Formula | C14H18N2O2 |
| CAS_number | 487-58-1 |
| MW | 246.30 |
|  |
| Paper | Yonekawa_2021_Bioorg.Med.Chem.Lett_47_128206 |
| Comment | Tryptophan betaine, fungal auxin antagonist. Betaines are synthesized or taken up from the environment by cells for protection against osmotic stress, drought, high salinity, or high temperature. Zwitterions quaternary ammonium or phosphonium cation that bears no hydrogen atom and with a negatively charged functional group not adjacent to the cationic site. Not proper alkaloid but often classified as such.Attenuates Lipopolysaccharide-Induced Endothelial Inflammation, induces sleep |
| Gene_locus | human-ACHE |
| CID | 442106 |
| | 3861164 |
| | 24189566 |
| Family | ACHE |
| InChIKey | AOHCBEAZXHZMOR-ZDUSSCGKSA-N |
| CanonicalSMILES | C[N+](C)(C)C(CC1=CNC2=CC=CC=C21)C(=O)[O-] |
| InChI | InChI=1S/C14H18N2O2/c1-16(2,3)13(14(17)18)8-10-9-15-12-7-5-4-6-11(10)12/h4-7,9,13,15H,8H2,1-3H3/t13-/m0/s1 |
|
|
|
