Inhibitor Report for: KK094
| KK094 | Type | Urea derivative |
|---|
| | Strigolactone receptors ligand |
| | Triazol |
| Other_Name | KOK |
| | 2,3-dihydroindol-1-yl(1,2,3-triazol-1-yl)methanone |
| Chemical_Nomenclature | (2,3-dihydro-1H-indol-1-yl)(1H-1,2,3-triazol-1-yl)methanone |
| Formula | C11H10N4O |
| MW | 214.22 |
|  |
| Paper (2) |
| Structure | 5ZHR |
| Comment | KK094 is a potent inhibitor of strigolactone receptors. KK094 inhibited SL-induced formation of the D14-D53 complex. KK094 was hydrolyzed by D14: a reaction product covalently binds to the Ser residue of the catalytic triad of D14. KK094 also inhibited the ShHTL7 receptor, however, with much lower efficiency, and reduced the rate of Striga seed germination |
| Gene_locus | orysj-Q10QA5 |
| | strhe-ShHTL7 |
| CID | 137349652 |
| Family | RsbQ-like |
| InChIKey | YHDLKWQIQYNPEK-UHFFFAOYSA-N |
| CanonicalSMILES | O=C(N1CCc2ccccc12)n1ccnn1 |
| InChI | 1S/C11H10N4O/c16-11(15-8-6-12-13-15)14-7-5-9-3-1-2-4-10(9)14/h1-4,6,8H,5,7H2 |
|
|
|
