Inhibitor Report for: Melatonin
Melatonin | Type | Derivative of Tryptamine |
| | Indole |
| | Not A/B H target |
| | Natural |
| Other_Name (7) |
| Chemical_Nomenclature | N-[2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide |
| Formula | C13H16N2O2 |
| CAS_number | 73-31-4 |
| MW | 232.28 |
| |
| Paper | Zhao_2019_J.Pineal.Res__e12630 |
| Structure | 6TR5 |
| Comment | Melatonin is a hormone produced by the pineal gland that has multiple effects including somnolence. The secretion of melatonin increases in darkness and decreases during exposure to light and is believed to play a role in regulation of the sleep-wake cycle. Melatonin is also implicated in the regulation of mood, learning and memory, immune activity, dreaming, fertility and reproduction. Melatonin is also an effective antioxidant. Most of the actions of melatonin are mediated through the binding and activation of melatonin receptors. |
| Gene_locus | human-NOTUM |
| CID | 896 |
| Family | Pectinacetylesterase-Notum |
| InChIKey | DRLFMBDRBRZALE-UHFFFAOYSA-N |
| CanonicalSMILES | CC(=O)NCCC1=CNC2=C1C=C(C=C2)OC |
| InChI | InChI=1S/C13H16N2O2/c1-9(16)14-6-5-10-8-15-13-4-3-11(17-2)7-12(10)13/h3-4,7-8,15H,5-6H2,1-2H3,(H,14,16) |
|
|