Substrate Report for: Methylbenzoate
Methylbenzoate | Type | Aryl ester |
| | Benzoate |
| Other_Name (5) |
| Chemical_Nomenclature | methyl benzoate |
| Formula | C8H8O2 |
| CAS_number | 93-58-3 |
| MW | 136.15 |
| |
| Paper | Martinez-Martinez_2018_ACS.Chem.Biol_13_225 |
| | Negre_2003_Plant.Cell_15_2992 |
| | Haase-Aschoff_2013_Process.Biochem_48_1872 |
| Comment | Methyl benzoate is found in all spice and present in various flower oils, banana, cherry, pimento berry, ceriman (Monstera deliciosa), clove bud and stem, mustard, coffee, black tea, dill, starfruit and cherimoya (Annona cherimola). Methyl benzoate is used in flavourings. It is one of many compounds that is attractive to males of various species of orchid bees, who apparently gather the chemical to synthesize pheromones; it is commonly used as bait to attract and collect these bees for study |
| Gene_locus | aurst-EJD51015 |
| CID | 7150 |
| Family | 6_AlphaBeta_hydrolase |
| InChIKey | QPJVMBTYPHYUOC-UHFFFAOYSA-N |
| CanonicalSMILES | COC(=O)C1=CC=CC=C1 |
| InChI | InChI=1S/C8H8O2/c1-10-8(9)7-5-3-2-4-6-7/h2-6H,1H3 |
|
|