Substrate Report for: N-(3-Carboxy-4-nitrophenyl)phthalamidic-acid
| N-(3-Carboxy-4-nitrophenyl)phthalamidic-acid | Type | pNP |
|---|
| | Phthalate |
| Other_Name | N-(3-Carboxy-4-nitrophenyl)phthalamidic acid |
| Chemical_Nomenclature | 5-[(2-carboxybenzoyl)amino]-2-nitrobenzoic acid |
| Formula | C15H10N2O7 |
| MW | 330.25 |
|  |
| Paper | Briggs_1996_J.Mol.Catal.B.Enzym_2_53 |
| | Black_1996_Biotechnol.Lett_18_875 |
| Comment | Chromogenic substrate to analyze . o-phthalyl amidase. Phthalimido is a stable protecting group in beta-lactam chemistry but no conventional chemical methods effectively removes this group. xanag-pham catalyzes the removal of the phthalyl group from phthalyl amides generating phthalate and an amine. The enzyme has a broad substrate specificity and hydrolyzes phthalylated amino acids, peptides, beta-lactams, aromatic and aliphatic amines |
| Gene_locus | xanag-pham |
| CID | 102001082 |
| Family | 6_AlphaBeta_hydrolase |
| InChIKey | ZQXCSGXRVQMUMI-UHFFFAOYSA-N |
| CanonicalSMILES | C1=CC=C(C(=C1)C(=O)NC2=CC(=C(C=C2)[N+](=O)[O-])C(=O)O)C(=O)O |
| InChI | InChI=1S/C15H10N2O7/c18-13(9-3-1-2-4-10(9)14(19)20)16-8-5-6-12(17(23)24)11(7-8)15(21)22/h1-7H,(H,16,18)(H,19,20)(H,21,22) |
|
|
|
