Substrate Report for: O-Demethylfonsecin
O-Demethylfonsecin | Type | Polyketide |
| Other_Name (5) |
| Chemical_Nomenclature | 2,5,6,8-tetrahydroxy-2-methyl-3H-benzo[g]chromen-4-one |
| Formula | C14H12O6 |
| MW | 276.24 |
| |
| Paper | Fujii_2004_J.Biol.Chem_279_44613 |
| Comment | O-Demethylfonsecin is a pigment from a mutant of Aspergillus fonsecaeus also known as Aspergillus carbonarius. YWA1 is a heptaketide that is 2,3-dihydro-4H-benzo[g]chromen-4-one bearing a methyl substituent at position 2 and four hydroxy substituents at positions 2, 5, 6 and 8. It has a role as an Aspergillus metabolite. It is a naphtho-gamma-pyrone, a cyclic hemiketal, a member of phenols and a heptaketide. |
| Gene_locus | aspfu-AYG1 |
| CID | 100923872 |
| Family | Duf_1100-S |
| | UPF0255 |
| InChIKey | RTYDQIKVNMHQMZ-UHFFFAOYSA-N |
| CanonicalSMILES | CC1(CC(=O)C2=C(C3=C(C=C(C=C3C=C2O1)O)O)O)O |
| InChI | InChI=1S/C14H12O6/c1-14(19)5-9(17)12-10(20-14)3-6-2-7(15)4-8(16)11(6)13(12)18/h2-4,15-16,18-19H,5H2,1H3 |
|
|