Inhibitor Report for: Omarigliptin
Omarigliptin | Type | Sulfur Compound |
| | Gliptin |
| | Pyrazole |
| Other_Name | MK-3102 |
| | MK3102 |
| | UNII-CVP59Q4JE1 |
| | CVP59Q4JE1 |
| Chemical_Nomenclature | (2R,3S,5R)-2-(2,5-difluorophenyl)-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)oxan-3-amine |
| Formula | C17H20F2N4O3S |
| CAS_number | 1226781-44-7 |
| MW | 398.42 |
| |
| Paper | Biftu_2014_J.Med.Chem_57_3205 |
| | Zhang_2023_Sci.Rep_13_14339 |
| Structure | 4PNZ |
| Comment | Omarigliptin is an investigational long-acting inhibitor of dipeptidyl peptidase 4 (DPP4). The first DPP4 inhibitor to be clinically approved was sitagliptin. This has subsequently been joined by several more drugs such as vildagliptin, saxagliptin, linagliptin and alogliptin. |
| Gene_locus | human-DPP4 |
| CID | 46209133 |
| Family | DPP4N_Peptidase_S9 |
| InChIKey | MKMPWKUAHLTIBJ-ISTRZQFTSA-N |
| CanonicalSMILES | CS(=O)(=O)N1C=C2CN(CC2=N1)C3CC(C(OC3)C4=C(C=CC(=C4)F)F)N |
| InChI | InChI=1S/C17H20F2N4O3S/c1-27(24,25)23-7-10-6-22(8-16(10)21-23)12-5-15(20)17(26-9-12)13-4-11(18)2-3-14(13)19/h2-4,7,12,15,17H,5-6,8-9,20H2,1H3/t12-,15+,17-/m1/s1 |
| IupharLig | 8402 |
| Wikipedia | Omarigliptin |
|
|