Inhibitor Report for: Piperine
Piperine | Type | Fragment inhibitor of Notum |
| | Piperidine |
| | Natural |
| | Benzodioxo |
| Other_Name | 1-Piperoylpiperidine |
| | Piperin |
| | Bioperine |
| Chemical_Nomenclature | (2E,4E)-5-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one |
| Formula | C17H19NO3 |
| CAS_number | 94-62-2 |
| MW | 285.34 |
| |
| Structure | 7BLW |
| Comment | Alkaloid isolated from the plant Piper nigrum. It has a role as a NF-kappaB inhibitor, a plant metabolite, a food component and a human blood serum metabolite. Piperine and its isomer chavicine, is the alkaloid responsible for the pungency of black pepper and long pepper |
| Gene_locus | human-NOTUM |
| CID | 638024 |
| Family | Pectinacetylesterase-Notum |
| InChIKey | MXXWOMGUGJBKIW-YPCIICBESA-N |
| CanonicalSMILES | C1CCN(CC1)C(=O)C=CC=CC2=CC3=C(C=C2)OCO3 |
| InChI | InChI=1S/C17H19NO3/c19-17(18-10-4-1-5-11-18)7-3-2-6-14-8-9-15-16(12-14)21-13-20-15/h2-3,6-9,12H,1,4-5,10-11,13H2/b6-2+,7-3+ |
| Wikipedia | Piperine |
|
|