Substrate Report for: Probenecid-glucuronide
Probenecid-glucuronide | Type (4) |
| Other_Name (5) |
| Chemical_Nomenclature | (2S,3S,4S,5R,6S)-6-[4-(dipropylsulfamoyl)benzoyl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
| Formula | C19H27NO10S |
| CAS_number | 34017-15-7 |
| MW | 461.48 |
| |
| Paper | Ito_2014_Drug.Metab.Dispos_42_2109 |
| Comment | Probenecid, a widely used uricosuric agent, is mainly metabolized to probenecid acyl glucuronide (PRAG), which is considered a causal substance of severe allergic or anaphylactoid reactions |
| Gene_locus | human-ABHD10 |
| CID | 182154 |
| Family | ABHD10 |
| InChIKey | BZOGRYWIYJNLDE-NAHJCDBISA-N |
| CanonicalSMILES | CCCN(CCC)S(=O)(=O)C1=CC=C(C=C1)C(=O)OC2C(C(C(C(O2)C(=O)O)O)O)O |
| InChI | InChI=1S/C19H27NO10S/c1-3-9-20(10-4-2)31(27,28)12-7-5-11(6-8-12)18(26)30-19-15(23)13(21)14(22)16(29-19)17(24)25/h5-8,13-16,19,21-23H,3-4,9-10H2,1-2H3,(H,24,25)/t13-,14-,15+,16-,19-/m0/s1 |
|
|