Substrate Report for: S-Formylglutathione
S-Formylglutathione | Type | Peptide |
| Other_Name | L-gamma-glutamyl-S-formyl-L-cysteinylglycine |
| | AC1L4O3B |
| | SCHEMBL380154 |
| | CHEBI:16225 |
| Chemical_Nomenclature | (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-3-formylsulfanyl-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| Formula | C11H17N3O7S |
| CAS_number | 50409-81-9 |
| MW | 335.33 |
| |
| Paper | Gonzalez_2006_J.Biol.Chem_281_14514 |
| Comment | detoxification of Formaldehyde: S-Hydroxymethylglutathione is spontaneously formed from the reaction of formaldehyde and glutathione. S-Formylglutathione is the product of formaldehyde dehydrogenase, an enzyme which catalyzes the oxidation of S-hydroxymethylglutathione. SFGH catalyzes the hydrolysis of S-formylglutathione to produce formate and glutathione. Formate is then oxidized to carbon dioxide by formate dehydrogenase, and glutathione is recycled in subsequent detoxification reactions. |
| Gene_locus | human-ESD |
| CID | 189122 |
| Family | A85-EsteraseD-FGH |
| | Antigen85c |
| InChIKey | FHXAGOICBFGEBF-BQBZGAKWSA-N |
| CanonicalSMILES | C(CC(=O)NC(CSC=O)C(=O)NCC(=O)O)C(C(=O)O)N |
| InChI | InChI=1S/C11H17N3O7S/c12-6(11(20)21)1-2-8(16)14-7(4-22-5-15)10(19)13-3-9(17)18/h5-7H,1-4,12H2,(H,13,19)(H,14,16)(H,17,18)(H,20,21)/t6-,7-/m0/s1 |
|
|