Inhibitor Report for: SN-38
SN-38 | Type | Drug |
| | Derivative of Irinotecan |
| | Not A/B H target |
| | Pro-Drug |
| Other_Name (10) |
| Chemical_Nomenclature | (19S)-10,19-diethyl-7,19-dihydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
| Formula | C22H20N2O5 |
| CAS_number | 86639-52-3 |
| MW | 392.4 |
| |
| Paper (27) |
| Comment | active metabolite of Irinotecan a chemotherapeutic pro-drug approved for the treatment of advanced colorectal cancer. Also product of hydrolysis of NPC product of hydrolysis of Irinotecan by 9sphn-E93 |
| Gene_locus | 9sphn-E93 |
| | human-CES2 |
| CID | 104842 |
| Family | Carb_B_Bacteria |
| | Carb_B_Chordata |
| InChIKey | FJHBVJOVLFPMQE-QFIPXVFZSA-N |
| CanonicalSMILES | CCC1=C2CN3C(=CC4=C(C3=O)COC(=O)C4(CC)O)C2=NC5=C1C=C(C=C5)O |
| InChI | InChI=1S/C22H20N2O5/c1-3-12-13-7-11(25)5-6-17(13)23-19-14(12)9-24-18(19)8-16-15(20(24)26)10-29-21(27)22(16,28)4-2/h5-8,25,28H,3-4,9-10H2,1-2H3/t22-/m0/s1 |
|
|