Substrate Report for: Simvastatin
Simvastatin | Type | Drug |
| | Not A/B H target |
| | Naphthalen |
| Other_Name | Zocor |
| | Synvinolin |
| | Sinvacor |
| | Denan |
| Chemical_Nomenclature | [(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
| Formula | C25H38O5 |
| CAS_number | 79902-63-9 |
| MW | 418.57 |
| |
| Paper | Knobloch_2016_Eur.J.Pharmacol_788_294 |
| | Wang_2015_Biol.Pharm.Bull_38_292 |
| | Li_2019_J.Pharm.Biomed.Anal_168_13 |
| Comment | Simvastatin is a lipid-lowering agent derived synthetically from a fermentation product of the fungus Aspergillus terreus. Hydrolyzed in vivo to an active metabolite, simvastatin competitively inhibits hepatic hydroxymethyl-glutaryl coenzyme A (HMG-CoA) reductase, the enzyme which catalyzes the conversion of HMG-CoA to mevalonate, a key step in cholesterol synthesis. This agent lowers plasma cholesterol and lipoprotein levels, and modulates immune responses by suppressing MHC II (major histocompatibility complex II) on interferon gamma-stimulated, antigen-presenting cells such as human vascular endothelial cells. Simvastatin is a prodrug hydrolysed by carboxylesterases. Simvastatin is a substrate of PON1, CES1b, PON3 and CES1c |
| Gene_locus | human-CES1 |
| | mouse-Ces1b |
| | mouse-Ces1c |
| CID | 54454 |
| Family | Carb_B_Chordata |
| InChIKey | RYMZZMVNJRMUDD-HGQWONQESA-N |
| CanonicalSMILES | CCC(C)(C)C(=O)OC1CC(C=C2C1C(C(C=C2)C)CCC3CC(CC(=O)O3)O)C |
| InChI | InChI=1S/C25H38O5/c1-6-25(4,5)24(28)30-21-12-15(2)11-17-8-7-16(3)20(23(17)21)10-9-19-13-18(26)14-22(27)29-19/h7-8,11,15-16,18-21,23,26H,6,9-10,12-14H2,1-5H3/t15-,16-,18+,19+,20-,21-,23-/m0/s1 |
|
|