Inhibitor Report for: Sofosbuvir
Sofosbuvir | Type | Pro-Drug |
| | Drug |
| | Not A/B H target |
| Other_Name (8) |
| Chemical_Nomenclature | propan-2-yl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-4-fluoro-3-hydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| Formula | C22H29FN3O9P |
| CAS_number | 1190307-88-0 |
| MW | 529.5 |
| |
| Paper | Murakami_2010_J.Biol.Chem_285_34337 |
| | Li_2021_Pharmaceutics_13_ |
| | Loucks_2022_Liver.Int_42_796 |
| | Eades_2022_Curr.Drug.Metab__ |
| Comment | Sofosbuvir is an orally available nucleotide prodrug and a hepatitis C virus (HCV) NS5B polymerase inhibitor with potential HCV inhibiting activity. Upon oral administration, sofosbuvir is metabolized to 2'-deoxy-2'-alpha-fluoro-beta-C-methyluridine-5'-monophosphate, which is then converted into the active triphosphate nucleotide that inhibits the NS5B polymerase, thereby preventing viral replication. |
| Gene_locus | human-CES2 |
| CID | 45375808 |
| Family | Carb_B_Chordata |
| InChIKey | TTZHDVOVKQGIBA-IQWMDFIBSA-N |
| CanonicalSMILES | CC(C)OC(=O)C(C)NP(=O)(OCC1C(C(C(O1)N2C=CC(=O)NC2=O)(C)F)O)OC3=CC=CC=C3 |
| InChI | InChI=1S/C22H29FN3O9P/c1-13(2)33-19(29)14(3)25-36(31,35-15-8-6-5-7-9-15)32-12-16-18(28)22(4,23)20(34-16)26-11-10-17(27)24-21(26)30/h5-11,13-14,16,18,20,28H,12H2,1-4H3,(H,25,31)(H,24,27,30)/t14-,16+,18+,20+,22+,36-/m0/s1 |
|
|