Substrate Report for: Tenofovir-alafenamide
Tenofovir-alafenamide | Type (4) |
| Other_Name (4) |
| Chemical_Nomenclature | propan-2-yl (2S)-2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-phenoxyphosphoryl]amino]propanoate |
| Formula | C21H29N6O5P |
| CAS_number | 379270-37-8 |
| MW | 476.5 |
| |
| Paper | Li_2021_Drug.Metab.Dispos__ |
| | Li_2021_Pharmaceutics_13_ |
| | Murakami_2015_Antimicrob.Agents.Chemother_59_3563 |
| | Birkus_2015_Antimicrob.Agents.Chemother_60_316 |
| | Bam_2014_Antivir.Ther_19_669 |
| | Birkus_2008_Mol.Pharmacol_74_92 |
| | Liu_2022_Biochem.Pharmacol_204_115224 |
| Comment | A prodrug for tenofovir (HIV-1 reverse transcriptase inhibitor), used in combination therapy for the treatment of HIV-1 infection. L-alanine derivative, a phosphoramidate ester |
| Gene_locus (2) |
| CID | 9574768 |
| Family (2) |
| InChIKey | LDEKQSIMHVQZJK-CAQYMETFSA-N |
| CanonicalSMILES | CC(C)OC(=O)C(C)NP(=O)(COC(C)CN1C=NC2=C(N=CN=C21)N)OC3=CC=CC=C3 |
| InChI | InChI=1S/C21H29N6O5P/c1-14(2)31-21(28)16(4)26-33(29,32-17-8-6-5-7-9-17)13-30-15(3)10-27-12-25-18-19(22)23-11-24-20(18)27/h5-9,11-12,14-16H,10,13H2,1-4H3,(H,26,29)(H2,22,23,24)/t15-,16+,33+/m1/s1 |
|
|