Inhibitor Report for: Tz2Pa6-anti1
| Tz2Pa6-anti1 | Type (5) |
|---|
| Other_Name | CHEMBL117651 |
| Chemical_Nomenclature | 3,8-Diamino-6-Phenyl-5-[6-[1-[2-[(1,2,3,4-tetrahydro-9-acridinyl)amino]ethyl]-1H-1,2,3-triazol-5-yl]hexyl] phenanthridinium |
| Formula | C42H45N8 |
|  |
| Paper (7) |
| Structure (6) |
| Comment | The AChE inhibitor TZ2PA6 results from 1,3-dipolar cycloaddition (click chemistry) between a PAS inhibitor (phenylphenanthridinium) equipped with an acetylene group at the end of a flexible methylene chain and an active site inhibitor (tacrine)equipped with an azide group at the end of a methylene chain |
| Gene_locus | mouse-ACHE |
| CID | 49786953 |
| Family | ACHE |
| InChIKey | IIHWAURNXZAECF-UHFFFAOYSA-O |
| CanonicalSMILES | C1=CC=C(C=C1)C2=C3C=C(C=CC3=C4C=CC(=CC4=[N+]2CCCCCCC5=CN(N=N5)CCNC6=C7C=CC=CC7=NC8=CC=CC=C86)N)N |
| InChI | InChI=1S/C42H40N8/c43-30-19-21-33-34-22-20-31(44)27-40(34)50(42(37(33)26-30)29-12-4-3-5-13-29)24-11-2-1-6-14-32-28-49(48-47-32)25-23-45-41-35-15-7-9-17-38(35)46-39-18-10-8-16-36(39)41/h3-5,7-10,12-13,15-22,26-28,44H,1-2,6,11,14,23-25,43H2,(H,45,46)/p+1 |
|
|
|
