Substrate Report for: Z-KR-pNA
Z-KR-pNA | Type | Benzyloxycarbonyl |
| | Peptide |
| | p-nitroaniline |
| Other_Name | ZINC71788455 |
| | Cbz-DL-Lys-DL-Arg-pNA |
| | Cbz-Lys-Arg-pNA |
| | Z-Lys-Arg-pNA |
| | Z-Lys-Arg-pNA inverted exclamation mark currency 2 HCl |
| Chemical_Nomenclature | benzyl N-[(2S)-6-amino-1-[[(2S)-5-(diaminomethylideneamino)-1-(4-nitroanilino)-1-oxopentan-2-yl]amino]-1-oxohexan-2-yl]carbamate |
| Formula | C26H36N8O6 |
| MW | 556.6 |
|  |
| Paper | Petrenko_2021_Biology.(Basel)_10_1021 |
| Comment | A chromogenic substrate that permits direct measurement of peptide hydrolase activity, e.g., Cathepsin B, papain, trypsin, pOP, BACE (not specific), by colorimetry. The substrate liberates p-nitroaniline as a chromogenic product CID 44134613 is the hydrochloride form Cbz-DL-Arg-DL-Arg-pNA.2HCl |
| Gene_locus | 9gamm-b3vi58 |
| CID | 95566027 |
| Family | S9N_PREPL_Peptidase_S9 |
| InChIKey | GSXIDHCDZTUNBT-VXKWHMMOSA-N |
| CanonicalSMILES | C1=CC=C(C=C1)COC(=O)NC(CCCCN)C(=O)NC(CCCN=C(N)N)C(=O)NC2=CC=C(C=C2)[N+](=O)[O-] |
| InChI | InChI=1S/C26H36N8O6/c27-15-5-4-9-22(33-26(37)40-17-18-7-2-1-3-8-18)24(36)32-21(10-6-16-30-25(28)29)23(35)31-19-11-13-20(14-12-19)34(38)39/h1-3,7-8,11-14,21-22H,4-6,9-10,15-17,27H2,(H,31,35)(H,32,36)(H,33,37)(H4,28,29,30)/t21-,22-/m0/s1 |
|
|