Inhibitor Report for: SBP-7635General | Type | | Thiazolidine, Sulfonamide, Sulfur Compound | | Chemical_Nomenclature | | N,N-diethyl-4-{2-[(2-fluorophenyl)methyl]-1,3-thiazol-4-yl}benzene-1-sulfonamid | | Canonical SMILES | | CCN(CC)S(=O)(=O)C1=CC=C(C=C1)C2=CSC(=N2)CC3=CC=CC=C3F | | InChI | | InChI=1S/C20H21FN2O2S2/c1-3-23(4-2)27(24,25)17-11-9-15(10-12-17)19-14-26-20(22-19)13-16-7-5-6-8-18(16)21/h5-12,14H,3-4,13H2,1-2H3 | | InChIKey | | PZNJPNGENGJLBG-UHFFFAOYSA-N
| | Other name(s) | | ZEP ; ~{N},~{N}-diethyl-4-[2-[(2-fluorophenyl)methyl]-1,3-thiazol-4-yl]benzenesulfonamide ; SCHEMBL17073141 |
________________________________________________________________________________________________ |
Target | Families | | | SBP-7635 ligand of proteins in family: Thioesterase | | Stucture | | | 1 structure: 7MHD: Thioesterase Domain of Human Fatty Acid Synthase (FASN-TE) binding a competitive inhibitor SBP-7635 | | Protein | | | human-FASN |
References: Search PubMed for references concerning: SBP-7635No Reference |
